C10H7BrO2 — CID 14867663
5-bromo-2,7-dioxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene (PubChem CID 14867663) has the molecular formula C10H7BrO2 and a molecular weight of 239.07 g/mol. Its IUPAC name is 5-bromo-2,7-dioxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene.
| Compound Name | 5-bromo-2,7-dioxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene |
|---|---|
| PubChem CID | 14867663 |
| Molecular Formula | C10H7BrO2 |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 5-bromo-2,7-dioxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene |
| SMILES | BrC1COc2cccc3occ1c23 |
| InChI | InChI=1S/C10H7BrO2/c11-7-5-13-9-3-1-2-8-10(9)6(7)4-12-8/h1-4,7H,5H2 |
| InChIKey | BVDPVTNIZJLVJB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|