C35H32F6O4S — CID 148685502
3-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonyl-7,7-dimethylbicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 148685502) has the molecular formula C35H32F6O4S and a molecular weight of 662.69 g/mol. Its IUPAC name is 3-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonyl-7,7-dimethylbicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 3-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonyl-7,7-dimethylbicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 148685502 |
| Molecular Formula | C35H32F6O4S |
| Molecular Weight | 662.69 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | 3-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonyl-7,7-dimethylbicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | CC(C)(C)Oc1ccc(C(c2ccc(Oc3ccc(S(=O)(=O)c4ccc5c(c4)CC5(C)C)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H32F6O4S/c1-31(2,3)45-27-12-8-24(9-13-27)33(34(36,37)38,35(39,40)41)23-6-10-25(11-7-23)44-26-14-16-28(17-15-26)46(42,43)29-18-19-30-22(20-29)21-32(30,4)5/h6-20H,21H2,1-5H3 |
| InChIKey | NSLNNFQIJTWIFH-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.69 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |