C11H17N — CID 14869783
(4E,6E)-3-propylocta-4,6-dienenitrile (PubChem CID 14869783) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (4E,6E)-3-propylocta-4,6-dienenitrile.
| Compound Name | (4E,6E)-3-propylocta-4,6-dienenitrile |
|---|---|
| PubChem CID | 14869783 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (4E,6E)-3-propylocta-4,6-dienenitrile |
| SMILES | C/C=C/C=C/C(CC#N)CCC |
| InChI | InChI=1S/C11H17N/c1-3-5-6-8-11(7-4-2)9-10-12/h3,5-6,8,11H,4,7,9H2,1-2H3/b5-3+,8-6+ |
| InChIKey | ICCNSIWSTLJKAH-QFXXITGJSA-N |
| XLogP | 3.45 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|