C46H62BN13O16S2 — CID 148709240
CID 148709240 (PubChem CID 148709240) has the molecular formula C46H62BN13O16S2 and a molecular weight of 1128.02 g/mol.
| Compound Name | CID 148709240 |
|---|---|
| PubChem CID | 148709240 |
| Molecular Formula | C46H62BN13O16S2 |
| Molecular Weight | 1128.02 g/mol |
| Exact Mass | 1127.40 |
| IUPAC Name | — |
| SMILES | [B]NC(=O)NCCOCCOCCNC(=O)[C@H](CCCCn1cc(CCCC(=O)Nc2nnc(S(N)(=O)=O)s2)nn1)NC(=O)C[C@H](NC(=O)C[C@H](NC(=O)CCC(C)(c1ccc(O)cc1)c1ccc(O)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C46H62BN13O16S2/c1-46(28-8-12-31(61)13-9-28,29-10-14-32(62)15-11-29)17-16-37(64)52-34(41(68)69)25-39(66)53-35(42(70)71)26-38(65)51-33(40(67)49-18-21-75-23-24-76-22-19-50-43(72)55-47)6-2-3-20-60-27-30(56-59-60)5-4-7-36(63)54-44-57-58-45(77-44)78(48,73)74/h8-15,27,33-35,61-62H,2-7,16-26H2,1H3,(H,49,67)(H,51,65)(H,52,64)(H,53,66)(H,68,69)(H,70,71)(H2,48,73,74)(H2,50,55,72)(H,54,57,63)/t33-,34-,35-/m0/s1 |
| InChIKey | GBFXILNTZDZYPT-IMKBVMFZSA-N |
| XLogP | -0.96 |
| TPSA | 436.80 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1128.02 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|