C53H41N3O — CID 148715856
2-[2'-[(1Z)-buta-1,3-dienyl]-3',6-dimethylspiro[6,7-dihydroxanthene-9,9'-fluorene]-3-yl]-4-(4-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 148715856) has the molecular formula C53H41N3O and a molecular weight of 735.93 g/mol. Its IUPAC name is 2-[2'-[(1Z)-buta-1,3-dienyl]-3',6-dimethylspiro[6,7-dihydroxanthene-9,9'-fluorene]-3-yl]-4-(4-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[2'-[(1Z)-buta-1,3-dienyl]-3',6-dimethylspiro[6,7-dihydroxanthene-9,9'-fluorene]-3-yl]-4-(4-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 148715856 |
| Molecular Formula | C53H41N3O |
| Molecular Weight | 735.93 g/mol |
| Exact Mass | 735.32 |
| IUPAC Name | 2-[2'-[(1Z)-buta-1,3-dienyl]-3',6-dimethylspiro[6,7-dihydroxanthene-9,9'-fluorene]-3-yl]-4-(4-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | C=C/C=C\c1cc2c(cc1C)-c1ccccc1C21C2=CCC(C)C=C2Oc2cc(-c3nc(-c4ccc(C)cc4)nc(-c4ccc(-c5ccccc5)cc4)n3)ccc21 |
| InChI | InChI=1S/C53H41N3O/c1-5-6-12-40-31-47-43(30-35(40)4)42-15-10-11-16-44(42)53(47)45-27-19-34(3)29-48(45)57-49-32-41(26-28-46(49)53)52-55-50(38-20-17-33(2)18-21-38)54-51(56-52)39-24-22-37(23-25-39)36-13-8-7-9-14-36/h5-18,20-32,34H,1,19H2,2-4H3/b12-6- |
| InChIKey | NYCDGSOSOBJGGC-SDQBBNPISA-N |
| XLogP | 12.91 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.93 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|