C19H31NO6 — CID 14872127
dimethyl 4-nitro-4-(3,3,5,5-tetramethylcyclohexen-1-yl)heptanedioate (PubChem CID 14872127) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is dimethyl 4-nitro-4-(3,3,5,5-tetramethylcyclohexen-1-yl)heptanedioate.
| Compound Name | dimethyl 4-nitro-4-(3,3,5,5-tetramethylcyclohexen-1-yl)heptanedioate |
|---|---|
| PubChem CID | 14872127 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | dimethyl 4-nitro-4-(3,3,5,5-tetramethylcyclohexen-1-yl)heptanedioate |
| SMILES | COC(=O)CCC(CCC(=O)OC)(C1=CC(C)(C)CC(C)(C)C1)[N+](=O)[O-] |
| InChI | InChI=1S/C19H31NO6/c1-17(2)11-14(12-18(3,4)13-17)19(20(23)24,9-7-15(21)25-5)10-8-16(22)26-6/h11H,7-10,12-13H2,1-6H3 |
| InChIKey | XKLHZSFLIGEFSB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|