C28H45NO6 — CID 91548613
dimethyl 4-nitro-4-nonadeca-4,7,10,13-tetraenylheptanedioate (PubChem CID 91548613) has the molecular formula C28H45NO6 and a molecular weight of 491.67 g/mol. Its IUPAC name is dimethyl 4-nitro-4-nonadeca-4,7,10,13-tetraenylheptanedioate.
| Compound Name | dimethyl 4-nitro-4-nonadeca-4,7,10,13-tetraenylheptanedioate |
|---|---|
| PubChem CID | 91548613 |
| Molecular Formula | C28H45NO6 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | dimethyl 4-nitro-4-nonadeca-4,7,10,13-tetraenylheptanedioate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(CCC(=O)OC)(CCC(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C28H45NO6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-28(29(32)33,24-21-26(30)34-2)25-22-27(31)35-3/h8-9,11-12,14-15,17-18H,4-7,10,13,16,19-25H2,1-3H3 |
| InChIKey | UWDUUQQDEMLGKT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|