methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate

C14H25NO4 — CID 21358813

IUPACmethyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate
SMILESCOC(=O)CC(CC(C)CCC=C(C)C)C[N+](=O)[O-]
InChIInChI=1S/C14H25NO4/c1-11(2)6-5-7-12(3)8-13(10-15(17)18)9-14(16)19-4/h6,12-13H,5,7-10H2,1-4H3
InChIKeyTXGDCRJJAXOLGZ-UHFFFAOYSA-N
MW271.36 g/mol
LogP3.21
Rot. Bonds9

About methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate

methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate (PubChem CID 21358813) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate.

Molecular Properties

Compound Namemethyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate
PubChem CID21358813
Molecular FormulaC14H25NO4
Molecular Weight271.36 g/mol
Exact Mass271.18
IUPAC Namemethyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate
SMILESCOC(=O)CC(CC(C)CCC=C(C)C)C[N+](=O)[O-]
InChIInChI=1S/C14H25NO4/c1-11(2)6-5-7-12(3)8-13(10-15(17)18)9-14(16)19-4/h6,12-13H,5,7-10H2,1-4H3
InChIKeyTXGDCRJJAXOLGZ-UHFFFAOYSA-N
XLogP3.21
TPSA69.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.36
LogP ≤ 53.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate?
The IUPAC name of methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate (CID 21358813) is methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate.
What is the SMILES notation for methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate?
The canonical SMILES for methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate is COC(=O)CC(CC(C)CCC=C(C)C)C[N+](=O)[O-].
What is the InChIKey of methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate?
The InChIKey is TXGDCRJJAXOLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO4/c1-11(2)6-5-7-12(3)8-13(10-15(17)18)9-14(16)19-4/h6,12-13H,5,7-10H2,1-4H3.
What are the key properties of methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate?
methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate has a molecular weight of 271.36 g/mol, XLogP of 3.21, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate is sourced from PubChem (CID 21358813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).