C14H25NO4 — CID 21358813
methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate (PubChem CID 21358813) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate.
| Compound Name | methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate |
|---|---|
| PubChem CID | 21358813 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | methyl 5,9-dimethyl-3-(nitromethyl)dec-8-enoate |
| SMILES | COC(=O)CC(CC(C)CCC=C(C)C)C[N+](=O)[O-] |
| InChI | InChI=1S/C14H25NO4/c1-11(2)6-5-7-12(3)8-13(10-15(17)18)9-14(16)19-4/h6,12-13H,5,7-10H2,1-4H3 |
| InChIKey | TXGDCRJJAXOLGZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|