C16H24FNO4 — CID 151496556
butyl 2-[(1R,5S,6S)-3-(2-fluoroethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 151496556) has the molecular formula C16H24FNO4 and a molecular weight of 313.37 g/mol. Its IUPAC name is butyl 2-[(1R,5S,6S)-3-(2-fluoroethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | butyl 2-[(1R,5S,6S)-3-(2-fluoroethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 151496556 |
| Molecular Formula | C16H24FNO4 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | butyl 2-[(1R,5S,6S)-3-(2-fluoroethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CCCCOC(=O)C[C@@]1(C[N+](=O)[O-])C[C@H]2CC(CCF)=C[C@H]21 |
| InChI | InChI=1S/C16H24FNO4/c1-2-3-6-22-15(19)10-16(11-18(20)21)9-13-7-12(4-5-17)8-14(13)16/h8,13-14H,2-7,9-11H2,1H3/t13-,14-,16-/m1/s1 |
| InChIKey | PPNQVTHELVJAHB-IIAWOOMASA-N |
| XLogP | 3.31 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|