C24H27FN6O4 — CID 148723829
2-[11-tert-butyl-5-(oxan-4-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide (PubChem CID 148723829) has the molecular formula C24H27FN6O4 and a molecular weight of 482.52 g/mol. Its IUPAC name is 2-[11-tert-butyl-5-(oxan-4-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide.
| Compound Name | 2-[11-tert-butyl-5-(oxan-4-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 148723829 |
| Molecular Formula | C24H27FN6O4 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 2-[11-tert-butyl-5-(oxan-4-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide |
| SMILES | CC(C)(C)c1cc2n(CC(=O)Nc3ccc(F)cn3)c3c(c(=O)n2n1)CN(C1CCOCC1)C3=O |
| InChI | InChI=1S/C24H27FN6O4/c1-24(2,3)17-10-20-30(13-19(32)27-18-5-4-14(25)11-26-18)21-16(22(33)31(20)28-17)12-29(23(21)34)15-6-8-35-9-7-15/h4-5,10-11,15H,6-9,12-13H2,1-3H3,(H,26,27,32) |
| InChIKey | NZPNCMADKHRHRM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |