C22H23FN6O4 — CID 142565155
2-[11-ethyl-5-(oxan-4-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide (PubChem CID 142565155) has the molecular formula C22H23FN6O4 and a molecular weight of 454.46 g/mol. Its IUPAC name is 2-[11-ethyl-5-(oxan-4-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide.
| Compound Name | 2-[11-ethyl-5-(oxan-4-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 142565155 |
| Molecular Formula | C22H23FN6O4 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-[11-ethyl-5-(oxan-4-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide |
| SMILES | CCc1cc2n(CC(=O)Nc3ccc(F)cn3)c3c(c(=O)n2n1)CN(C1CCOCC1)C3=O |
| InChI | InChI=1S/C22H23FN6O4/c1-2-14-9-19-28(12-18(30)25-17-4-3-13(23)10-24-17)20-16(21(31)29(19)26-14)11-27(22(20)32)15-5-7-33-8-6-15/h3-4,9-10,15H,2,5-8,11-12H2,1H3,(H,24,25,30) |
| InChIKey | UMMUFBYTHMSVLX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |