C16H12F3NO — CID 148731436
[2-[6-(trifluoromethyl)-1H-isoindol-4-yl]phenyl]methanol (PubChem CID 148731436) has the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. Its IUPAC name is [2-[6-(trifluoromethyl)-1H-isoindol-4-yl]phenyl]methanol.
| Compound Name | [2-[6-(trifluoromethyl)-1H-isoindol-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 148731436 |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | [2-[6-(trifluoromethyl)-1H-isoindol-4-yl]phenyl]methanol |
| SMILES | OCc1ccccc1-c1cc(C(F)(F)F)cc2c1C=NC2 |
| InChI | InChI=1S/C16H12F3NO/c17-16(18,19)12-5-11-7-20-8-15(11)14(6-12)13-4-2-1-3-10(13)9-21/h1-6,8,21H,7,9H2 |
| InChIKey | OBASAJWWNNESMB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |