C17H23NSi2 — CID 14874797
2-benzyl-1,1,3,3-tetramethyl-2,1,3-benzazadisilole (PubChem CID 14874797) has the molecular formula C17H23NSi2 and a molecular weight of 297.55 g/mol. Its IUPAC name is 2-benzyl-1,1,3,3-tetramethyl-2,1,3-benzazadisilole.
| Compound Name | 2-benzyl-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 14874797 |
| Molecular Formula | C17H23NSi2 |
| Molecular Weight | 297.55 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-benzyl-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
| SMILES | C[Si]1(C)c2ccccc2[Si](C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H23NSi2/c1-19(2)16-12-8-9-13-17(16)20(3,4)18(19)14-15-10-6-5-7-11-15/h5-13H,14H2,1-4H3 |
| InChIKey | CQXGCFFNSLTAJW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|