About CID 148762537
CID 148762537 (PubChem CID 148762537) has the molecular formula C5H9INO2-
and a molecular weight of 242.04 g/mol.
Molecular Properties
| Compound Name | CID 148762537 |
| PubChem CID | 148762537 |
| Molecular Formula | C5H9INO2- |
| Molecular Weight | 242.04 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])C1CCC[I-]C1 |
| InChI | InChI=1S/C5H9INO2/c8-7(9)5-2-1-3-6-4-5/h5H,1-4H2/q-1 |
| InChIKey | ISCYIGFUKKBMAO-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.04 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 148762537 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 148762537?
The IUPAC name of CID 148762537 (CID 148762537) is not available.
What is the SMILES notation for CID 148762537?
The canonical SMILES for CID 148762537 is O=[N+]([O-])C1CCC[I-]C1.
What is the InChIKey of CID 148762537?
The InChIKey is ISCYIGFUKKBMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9INO2/c8-7(9)5-2-1-3-6-4-5/h5H,1-4H2/q-1.
What are the key properties of CID 148762537?
CID 148762537 has a molecular weight of 242.04 g/mol, XLogP of -2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 148762537 is sourced from PubChem (CID 148762537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).