About 3-nitroazetidine
3-nitroazetidine (PubChem CID 67966002) has the molecular formula C3H6N2O2
and a molecular weight of 102.09 g/mol. Its IUPAC name is 3-nitroazetidine.
Molecular Properties
| Compound Name | 3-nitroazetidine |
| PubChem CID | 67966002 |
| Molecular Formula | C3H6N2O2 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.04 |
| IUPAC Name | 3-nitroazetidine |
| SMILES | O=[N+]([O-])C1CNC1 |
| InChI | InChI=1S/C3H6N2O2/c6-5(7)3-1-4-2-3/h3-4H,1-2H2 |
| InChIKey | HUDBUXGVPZKSKH-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitroazetidine?
The IUPAC name of 3-nitroazetidine (CID 67966002) is 3-nitroazetidine.
What is the SMILES notation for 3-nitroazetidine?
The canonical SMILES for 3-nitroazetidine is O=[N+]([O-])C1CNC1.
What is the InChIKey of 3-nitroazetidine?
The InChIKey is HUDBUXGVPZKSKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O2/c6-5(7)3-1-4-2-3/h3-4H,1-2H2.
What are the key properties of 3-nitroazetidine?
3-nitroazetidine has a molecular weight of 102.09 g/mol, XLogP of -0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitroazetidine is sourced from PubChem (CID 67966002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).