About 2-nitroimidazolidine
2-nitroimidazolidine (PubChem CID 19360746) has the molecular formula C3H7N3O2
and a molecular weight of 117.11 g/mol. Its IUPAC name is 2-nitroimidazolidine.
Molecular Properties
| Compound Name | 2-nitroimidazolidine |
| PubChem CID | 19360746 |
| Molecular Formula | C3H7N3O2 |
| Molecular Weight | 117.11 g/mol |
| Exact Mass | 117.05 |
| IUPAC Name | 2-nitroimidazolidine |
| SMILES | O=[N+]([O-])C1NCCN1 |
| InChI | InChI=1S/C3H7N3O2/c7-6(8)3-4-1-2-5-3/h3-5H,1-2H2 |
| InChIKey | LJOSITONLOZENU-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.11 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroimidazolidine?
The IUPAC name of 2-nitroimidazolidine (CID 19360746) is 2-nitroimidazolidine.
What is the SMILES notation for 2-nitroimidazolidine?
The canonical SMILES for 2-nitroimidazolidine is O=[N+]([O-])C1NCCN1.
What is the InChIKey of 2-nitroimidazolidine?
The InChIKey is LJOSITONLOZENU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O2/c7-6(8)3-4-1-2-5-3/h3-5H,1-2H2.
What are the key properties of 2-nitroimidazolidine?
2-nitroimidazolidine has a molecular weight of 117.11 g/mol, XLogP of -1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroimidazolidine is sourced from PubChem (CID 19360746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).