C2H6N4O6P+ — CID 177475102
(2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate (PubChem CID 177475102) has the molecular formula C2H6N4O6P+ and a molecular weight of 213.07 g/mol. Its IUPAC name is (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate.
| Compound Name | (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate |
|---|---|
| PubChem CID | 177475102 |
| Molecular Formula | C2H6N4O6P+ |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate |
| SMILES | O=[N+]([O-])O[P+]1(O[N+](=O)[O-])NCCN1 |
| InChI | InChI=1S/C2H6N4O6P/c7-5(8)11-13(12-6(9)10)3-1-2-4-13/h3-4H,1-2H2/q+1 |
| InChIKey | YWSXFLFTNGRWEI-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|