(2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate

C2H6N4O6P+ — CID 177475102

IUPAC(2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate
SMILESO=[N+]([O-])O[P+]1(O[N+](=O)[O-])NCCN1
InChIInChI=1S/C2H6N4O6P/c7-5(8)11-13(12-6(9)10)3-1-2-4-13/h3-4H,1-2H2/q+1
InChIKeyYWSXFLFTNGRWEI-UHFFFAOYSA-N
MW213.07 g/mol
LogP-0.73
Rot. Bonds4

About (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate

(2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate (PubChem CID 177475102) has the molecular formula C2H6N4O6P+ and a molecular weight of 213.07 g/mol. Its IUPAC name is (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate.

Molecular Properties

Compound Name(2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate
PubChem CID177475102
Molecular FormulaC2H6N4O6P+
Molecular Weight213.07 g/mol
Exact Mass213.00
IUPAC Name(2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate
SMILESO=[N+]([O-])O[P+]1(O[N+](=O)[O-])NCCN1
InChIInChI=1S/C2H6N4O6P/c7-5(8)11-13(12-6(9)10)3-1-2-4-13/h3-4H,1-2H2/q+1
InChIKeyYWSXFLFTNGRWEI-UHFFFAOYSA-N
XLogP-0.73
TPSA128.80 Ų
H-Bond Donors2
H-Bond Acceptors8
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.07
LogP ≤ 5-0.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate?
The IUPAC name of (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate (CID 177475102) is (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate.
What is the SMILES notation for (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate?
The canonical SMILES for (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate is O=[N+]([O-])O[P+]1(O[N+](=O)[O-])NCCN1.
What is the InChIKey of (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate?
The InChIKey is YWSXFLFTNGRWEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N4O6P/c7-5(8)11-13(12-6(9)10)3-1-2-4-13/h3-4H,1-2H2/q+1.
What are the key properties of (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate?
(2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate has a molecular weight of 213.07 g/mol, XLogP of -0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrooxy-1,3,2-diazaphospholidin-2-ium-2-yl) nitrate is sourced from PubChem (CID 177475102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).