About 2-nitro-2,5-dihydro-1H-pyrrole
2-nitro-2,5-dihydro-1H-pyrrole (PubChem CID 123517851) has the molecular formula C4H6N2O2
and a molecular weight of 114.10 g/mol. Its IUPAC name is 2-nitro-2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 2-nitro-2,5-dihydro-1H-pyrrole |
| PubChem CID | 123517851 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 2-nitro-2,5-dihydro-1H-pyrrole |
| SMILES | O=[N+]([O-])C1C=CCN1 |
| InChI | InChI=1S/C4H6N2O2/c7-6(8)4-2-1-3-5-4/h1-2,4-5H,3H2 |
| InChIKey | TZIVCRSGPOCMCX-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-2,5-dihydro-1H-pyrrole?
The IUPAC name of 2-nitro-2,5-dihydro-1H-pyrrole (CID 123517851) is 2-nitro-2,5-dihydro-1H-pyrrole.
What is the SMILES notation for 2-nitro-2,5-dihydro-1H-pyrrole?
The canonical SMILES for 2-nitro-2,5-dihydro-1H-pyrrole is O=[N+]([O-])C1C=CCN1.
What is the InChIKey of 2-nitro-2,5-dihydro-1H-pyrrole?
The InChIKey is TZIVCRSGPOCMCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2/c7-6(8)4-2-1-3-5-4/h1-2,4-5H,3H2.
What are the key properties of 2-nitro-2,5-dihydro-1H-pyrrole?
2-nitro-2,5-dihydro-1H-pyrrole has a molecular weight of 114.10 g/mol, XLogP of -0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 123517851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).