About 2,3-dinitroazetidine;hydrochloride
2,3-dinitroazetidine;hydrochloride (PubChem CID 126582236) has the molecular formula C3H6ClN3O4
and a molecular weight of 183.55 g/mol. Its IUPAC name is 2,3-dinitroazetidine;hydrochloride.
Molecular Properties
| Compound Name | 2,3-dinitroazetidine;hydrochloride |
| PubChem CID | 126582236 |
| Molecular Formula | C3H6ClN3O4 |
| Molecular Weight | 183.55 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | 2,3-dinitroazetidine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])C1CNC1[N+](=O)[O-] |
| InChI | InChI=1S/C3H5N3O4.ClH/c7-5(8)2-1-4-3(2)6(9)10;/h2-4H,1H2;1H |
| InChIKey | LLNJKHWDOIZGML-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.55 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dinitroazetidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dinitroazetidine;hydrochloride?
The IUPAC name of 2,3-dinitroazetidine;hydrochloride (CID 126582236) is 2,3-dinitroazetidine;hydrochloride.
What is the SMILES notation for 2,3-dinitroazetidine;hydrochloride?
The canonical SMILES for 2,3-dinitroazetidine;hydrochloride is Cl.O=[N+]([O-])C1CNC1[N+](=O)[O-].
What is the InChIKey of 2,3-dinitroazetidine;hydrochloride?
The InChIKey is LLNJKHWDOIZGML-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O4.ClH/c7-5(8)2-1-4-3(2)6(9)10;/h2-4H,1H2;1H.
What are the key properties of 2,3-dinitroazetidine;hydrochloride?
2,3-dinitroazetidine;hydrochloride has a molecular weight of 183.55 g/mol, XLogP of -0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dinitroazetidine;hydrochloride is sourced from PubChem (CID 126582236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).