About trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane
trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane (PubChem CID 102484537) has the molecular formula C4H4F3NO2
and a molecular weight of 155.07 g/mol. Its IUPAC name is trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane.
Molecular Properties
| Compound Name | trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane |
| PubChem CID | 102484537 |
| Molecular Formula | C4H4F3NO2 |
| Molecular Weight | 155.07 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane |
| SMILES | O=[N+]([O-])[C@@H]1C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C4H4F3NO2/c5-4(6,7)2-1-3(2)8(9)10/h2-3H,1H2/t2-,3-/m1/s1 |
| InChIKey | NSFSOHGRROEBMR-PWNYCUMCSA-N |
| XLogP | 1.21 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.07 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane?
The IUPAC name of trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane (CID 102484537) is trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane.
What is the SMILES notation for trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane?
The canonical SMILES for trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane is O=[N+]([O-])[C@@H]1C[C@H]1C(F)(F)F.
What is the InChIKey of trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane?
The InChIKey is NSFSOHGRROEBMR-PWNYCUMCSA-N. The full InChI is InChI=1S/C4H4F3NO2/c5-4(6,7)2-1-3(2)8(9)10/h2-3H,1H2/t2-,3-/m1/s1.
What are the key properties of trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane?
trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane has a molecular weight of 155.07 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane is sourced from PubChem (CID 102484537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).