C4H4F3NO2 — CID 102484537
trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane (PubChem CID 102484537) has the molecular formula C4H4F3NO2 and a molecular weight of 155.07 g/mol. Its IUPAC name is trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane.
| Compound Name | trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane |
|---|---|
| PubChem CID | 102484537 |
| Molecular Formula | C4H4F3NO2 |
| Molecular Weight | 155.07 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | trans-(1R,2R)-1-nitro-2-(trifluoromethyl)cyclopropane |
| SMILES | O=[N+]([O-])[C@@H]1C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C4H4F3NO2/c5-4(6,7)2-1-3(2)8(9)10/h2-3H,1H2/t2-,3-/m1/s1 |
| InChIKey | NSFSOHGRROEBMR-PWNYCUMCSA-N |
| XLogP | 1.21 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.07 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|