C11H17F3N2O4 — CID 97357616
tert-butyl (3R,4S)-3-nitro-4-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 97357616) has the molecular formula C11H17F3N2O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-nitro-4-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-nitro-4-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97357616 |
| Molecular Formula | C11H17F3N2O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | tert-butyl (3R,4S)-3-nitro-4-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C(F)(F)F)[C@@H]([N+](=O)[O-])C1 |
| InChI | InChI=1S/C11H17F3N2O4/c1-10(2,3)20-9(17)15-5-4-7(11(12,13)14)8(6-15)16(18)19/h7-8H,4-6H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | BPSJGQQZMDCNDH-YUMQZZPRSA-N |
| XLogP | 2.45 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|