C6H10N2O6 — CID 140689822
3,5-dinitrocyclohexane-1,2-diol (PubChem CID 140689822) has the molecular formula C6H10N2O6 and a molecular weight of 206.15 g/mol. Its IUPAC name is 3,5-dinitrocyclohexane-1,2-diol.
| Compound Name | 3,5-dinitrocyclohexane-1,2-diol |
|---|---|
| PubChem CID | 140689822 |
| Molecular Formula | C6H10N2O6 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 3,5-dinitrocyclohexane-1,2-diol |
| SMILES | O=[N+]([O-])C1CC(O)C(O)C([N+](=O)[O-])C1 |
| InChI | InChI=1S/C6H10N2O6/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h3-6,9-10H,1-2H2 |
| InChIKey | ZEMLGTSALRPWFP-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|