C6H9F3N2O2 — CID 97357613
(3S,4S)-3-nitro-4-(trifluoromethyl)piperidine (PubChem CID 97357613) has the molecular formula C6H9F3N2O2 and a molecular weight of 198.14 g/mol. Its IUPAC name is (3S,4S)-3-nitro-4-(trifluoromethyl)piperidine.
| Compound Name | (3S,4S)-3-nitro-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 97357613 |
| Molecular Formula | C6H9F3N2O2 |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (3S,4S)-3-nitro-4-(trifluoromethyl)piperidine |
| SMILES | O=[N+]([O-])[C@@H]1CNCC[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2O2/c7-6(8,9)4-1-2-10-3-5(4)11(12)13/h4-5,10H,1-3H2/t4-,5+/m0/s1 |
| InChIKey | MSPXIMIRWLDQCX-CRCLSJGQSA-N |
| XLogP | 0.80 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|