About 5-nitrotetrazolidine
5-nitrotetrazolidine (PubChem CID 89199840) has the molecular formula CH5N5O2
and a molecular weight of 119.08 g/mol. Its IUPAC name is 5-nitrotetrazolidine.
Molecular Properties
| Compound Name | 5-nitrotetrazolidine |
| PubChem CID | 89199840 |
| Molecular Formula | CH5N5O2 |
| Molecular Weight | 119.08 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | 5-nitrotetrazolidine |
| SMILES | O=[N+]([O-])C1NNNN1 |
| InChI | InChI=1S/CH5N5O2/c7-6(8)1-2-4-5-3-1/h1-5H |
| InChIKey | BEUGPHXMEODYDN-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.08 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrotetrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrotetrazolidine?
The IUPAC name of 5-nitrotetrazolidine (CID 89199840) is 5-nitrotetrazolidine.
What is the SMILES notation for 5-nitrotetrazolidine?
The canonical SMILES for 5-nitrotetrazolidine is O=[N+]([O-])C1NNNN1.
What is the InChIKey of 5-nitrotetrazolidine?
The InChIKey is BEUGPHXMEODYDN-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5N5O2/c7-6(8)1-2-4-5-3-1/h1-5H.
What are the key properties of 5-nitrotetrazolidine?
5-nitrotetrazolidine has a molecular weight of 119.08 g/mol, XLogP of -2.34, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrotetrazolidine is sourced from PubChem (CID 89199840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).