C12H12N2O4 — CID 125036320
(1S,4S,6S,10S)-5,11-dinitrohexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane (PubChem CID 125036320) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is (1S,4S,6S,10S)-5,11-dinitrohexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane.
| Compound Name | (1S,4S,6S,10S)-5,11-dinitrohexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane |
|---|---|
| PubChem CID | 125036320 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (1S,4S,6S,10S)-5,11-dinitrohexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane |
| SMILES | O=[N+]([O-])C1[C@H]2C3C4C5C3[C@H]3C2C([C@H]41)[C@H]5C3[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N2O4/c15-13(16)11-7-1-2-4-3(1)9(11)6-5(7)8(2)12(10(4)6)14(17)18/h1-12H/t1?,2?,3?,4?,5?,6?,7-,8-,9-,10-,11?,12?/m0/s1 |
| InChIKey | VRRKKZACJDWASH-WKSWPHAJSA-N |
| XLogP | 0.52 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|