About 1,4-dinitropyrazine
1,4-dinitropyrazine (PubChem CID 175415931) has the molecular formula C4H4N4O4
and a molecular weight of 172.10 g/mol. Its IUPAC name is 1,4-dinitropyrazine.
Molecular Properties
| Compound Name | 1,4-dinitropyrazine |
| PubChem CID | 175415931 |
| Molecular Formula | C4H4N4O4 |
| Molecular Weight | 172.10 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | 1,4-dinitropyrazine |
| SMILES | O=[N+]([O-])N1C=CN([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C4H4N4O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H |
| InChIKey | YNCQRWWRLVMDGN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.10 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dinitropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dinitropyrazine?
The IUPAC name of 1,4-dinitropyrazine (CID 175415931) is 1,4-dinitropyrazine.
What is the SMILES notation for 1,4-dinitropyrazine?
The canonical SMILES for 1,4-dinitropyrazine is O=[N+]([O-])N1C=CN([N+](=O)[O-])C=C1.
What is the InChIKey of 1,4-dinitropyrazine?
The InChIKey is YNCQRWWRLVMDGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N4O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H.
What are the key properties of 1,4-dinitropyrazine?
1,4-dinitropyrazine has a molecular weight of 172.10 g/mol, XLogP of -0.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dinitropyrazine is sourced from PubChem (CID 175415931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).