C10H11N5O10 — CID 86087234
2,4,6,8,9-pentanitroadamantane (PubChem CID 86087234) has the molecular formula C10H11N5O10 and a molecular weight of 361.22 g/mol. Its IUPAC name is 2,4,6,8,9-pentanitroadamantane.
| Compound Name | 2,4,6,8,9-pentanitroadamantane |
|---|---|
| PubChem CID | 86087234 |
| Molecular Formula | C10H11N5O10 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2,4,6,8,9-pentanitroadamantane |
| SMILES | O=[N+]([O-])C1C2CC3C([N+](=O)[O-])C1C([N+](=O)[O-])C(C2[N+](=O)[O-])C3[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N5O10/c16-11(17)6-2-1-3-8(13(20)21)4(6)10(15(24)25)5(7(2)12(18)19)9(3)14(22)23/h2-10H,1H2 |
| InChIKey | ZODYZAWAKSSMIU-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 215.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|