C5H5ClN2O2 — CID 143640173
6-chloro-4-nitro-1,2-dihydropyridine (PubChem CID 143640173) has the molecular formula C5H5ClN2O2 and a molecular weight of 160.56 g/mol. Its IUPAC name is 6-chloro-4-nitro-1,2-dihydropyridine.
| Compound Name | 6-chloro-4-nitro-1,2-dihydropyridine |
|---|---|
| PubChem CID | 143640173 |
| Molecular Formula | C5H5ClN2O2 |
| Molecular Weight | 160.56 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | 6-chloro-4-nitro-1,2-dihydropyridine |
| SMILES | O=[N+]([O-])C1=CCNC(Cl)=C1 |
| InChI | InChI=1S/C5H5ClN2O2/c6-5-3-4(8(9)10)1-2-7-5/h1,3,7H,2H2 |
| InChIKey | GIJWAMHJOUNXAA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.56 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|