C6H7ClN2O2 — CID 153064228
3-chloro-6-nitrocyclohexa-1,3-dien-1-amine (PubChem CID 153064228) has the molecular formula C6H7ClN2O2 and a molecular weight of 174.59 g/mol. Its IUPAC name is 3-chloro-6-nitrocyclohexa-1,3-dien-1-amine.
| Compound Name | 3-chloro-6-nitrocyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 153064228 |
| Molecular Formula | C6H7ClN2O2 |
| Molecular Weight | 174.59 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 3-chloro-6-nitrocyclohexa-1,3-dien-1-amine |
| SMILES | NC1=CC(Cl)=CCC1[N+](=O)[O-] |
| InChI | InChI=1S/C6H7ClN2O2/c7-4-1-2-6(9(10)11)5(8)3-4/h1,3,6H,2,8H2 |
| InChIKey | VKAYRKNPGLNFJB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.59 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|