About sodium;hydride;5-nitro-1,3-dioxane
sodium;hydride;5-nitro-1,3-dioxane (PubChem CID 174884511) has the molecular formula C4H8NNaO4
and a molecular weight of 157.10 g/mol. Its IUPAC name is sodium;hydride;5-nitro-1,3-dioxane.
Molecular Properties
| Compound Name | sodium;hydride;5-nitro-1,3-dioxane |
| PubChem CID | 174884511 |
| Molecular Formula | C4H8NNaO4 |
| Molecular Weight | 157.10 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | sodium;hydride;5-nitro-1,3-dioxane |
| SMILES | O=[N+]([O-])C1COCOC1.[H-].[Na+] |
| InChI | InChI=1S/C4H7NO4.Na.H/c6-5(7)4-1-8-3-9-2-4;;/h4H,1-3H2;;/q;+1;-1 |
| InChIKey | NJBAYYGYXMGTGL-UHFFFAOYSA-N |
| XLogP | -3.25 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.10 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;5-nitro-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;5-nitro-1,3-dioxane?
The IUPAC name of sodium;hydride;5-nitro-1,3-dioxane (CID 174884511) is sodium;hydride;5-nitro-1,3-dioxane.
What is the SMILES notation for sodium;hydride;5-nitro-1,3-dioxane?
The canonical SMILES for sodium;hydride;5-nitro-1,3-dioxane is O=[N+]([O-])C1COCOC1.[H-].[Na+].
What is the InChIKey of sodium;hydride;5-nitro-1,3-dioxane?
The InChIKey is NJBAYYGYXMGTGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO4.Na.H/c6-5(7)4-1-8-3-9-2-4;;/h4H,1-3H2;;/q;+1;-1.
What are the key properties of sodium;hydride;5-nitro-1,3-dioxane?
sodium;hydride;5-nitro-1,3-dioxane has a molecular weight of 157.10 g/mol, XLogP of -3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;5-nitro-1,3-dioxane is sourced from PubChem (CID 174884511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).