About lithium;1,3-dioxolane;nitrate
lithium;1,3-dioxolane;nitrate (PubChem CID 172683754) has the molecular formula C3H6LiNO5
and a molecular weight of 143.02 g/mol. Its IUPAC name is lithium;1,3-dioxolane;nitrate.
Molecular Properties
| Compound Name | lithium;1,3-dioxolane;nitrate |
| PubChem CID | 172683754 |
| Molecular Formula | C3H6LiNO5 |
| Molecular Weight | 143.02 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | lithium;1,3-dioxolane;nitrate |
| SMILES | C1COCO1.O=[N+]([O-])[O-].[Li+] |
| InChI | InChI=1S/C3H6O2.Li.NO3/c1-2-5-3-4-1;;2-1(3)4/h1-3H2;;/q;+1;-1 |
| InChIKey | ATGQUKRKPMRRGF-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.02 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze lithium;1,3-dioxolane;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1,3-dioxolane;nitrate?
The IUPAC name of lithium;1,3-dioxolane;nitrate (CID 172683754) is lithium;1,3-dioxolane;nitrate.
What is the SMILES notation for lithium;1,3-dioxolane;nitrate?
The canonical SMILES for lithium;1,3-dioxolane;nitrate is C1COCO1.O=[N+]([O-])[O-].[Li+].
What is the InChIKey of lithium;1,3-dioxolane;nitrate?
The InChIKey is ATGQUKRKPMRRGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.Li.NO3/c1-2-5-3-4-1;;2-1(3)4/h1-3H2;;/q;+1;-1.
What are the key properties of lithium;1,3-dioxolane;nitrate?
lithium;1,3-dioxolane;nitrate has a molecular weight of 143.02 g/mol, XLogP of -3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1,3-dioxolane;nitrate is sourced from PubChem (CID 172683754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).