C18H13ClN2OS — CID 1487627
N-(3-chlorophenyl)-4-methylthieno[2,3-b]indole-2-carboxamide (PubChem CID 1487627) has the molecular formula C18H13ClN2OS and a molecular weight of 340.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-methylthieno[2,3-b]indole-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-methylthieno[2,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 1487627 |
| Molecular Formula | C18H13ClN2OS |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-(3-chlorophenyl)-4-methylthieno[2,3-b]indole-2-carboxamide |
| SMILES | Cn1c2ccccc2c2cc(C(=O)Nc3cccc(Cl)c3)sc21 |
| InChI | InChI=1S/C18H13ClN2OS/c1-21-15-8-3-2-7-13(15)14-10-16(23-18(14)21)17(22)20-12-6-4-5-11(19)9-12/h2-10H,1H3,(H,20,22) |
| InChIKey | CQPGPQGNHNJBNC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |