About methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate
methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate (PubChem CID 148763113) has the molecular formula C9H11N3O4
and a molecular weight of 225.20 g/mol. Its IUPAC name is methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate.
Molecular Properties
| Compound Name | methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate |
| PubChem CID | 148763113 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate |
| SMILES | COC(=O)c1nc2n(c(=O)c1O)CC(C)N2 |
| InChI | InChI=1S/C9H11N3O4/c1-4-3-12-7(14)6(13)5(8(15)16-2)11-9(12)10-4/h4,13H,3H2,1-2H3,(H,10,11) |
| InChIKey | OGYBJAPXGIYUFP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate?
The IUPAC name of methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate (CID 148763113) is methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate.
What is the SMILES notation for methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate?
The canonical SMILES for methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate is COC(=O)c1nc2n(c(=O)c1O)CC(C)N2.
What is the InChIKey of methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate?
The InChIKey is OGYBJAPXGIYUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O4/c1-4-3-12-7(14)6(13)5(8(15)16-2)11-9(12)10-4/h4,13H,3H2,1-2H3,(H,10,11).
What are the key properties of methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate?
methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate has a molecular weight of 225.20 g/mol, XLogP of -0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-hydroxy-2-methyl-5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyrimidine-7-carboxylate is sourced from PubChem (CID 148763113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).