C35H36IN5O3 — CID 148767963
(6S,9aS)-N-benzyl-8-(2,2-diphenylethyl)-6-(1λ3-iodacyclohexa-1,3,5-trien-3-ylmethyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 148767963) has the molecular formula C35H36IN5O3 and a molecular weight of 701.61 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-(2,2-diphenylethyl)-6-(1λ3-iodacyclohexa-1,3,5-trien-3-ylmethyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-(2,2-diphenylethyl)-6-(1λ3-iodacyclohexa-1,3,5-trien-3-ylmethyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 148767963 |
| Molecular Formula | C35H36IN5O3 |
| Molecular Weight | 701.61 g/mol |
| Exact Mass | 701.19 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-(2,2-diphenylethyl)-6-(1λ3-iodacyclohexa-1,3,5-trien-3-ylmethyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CN1CC(=O)N2[C@@H](CC3=CC=CI=C3)C(=O)N(CC(c3ccccc3)c3ccccc3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C35H36IN5O3/c1-38-25-33(42)40-31(20-27-14-11-19-36-21-27)34(43)39(23-30(28-15-7-3-8-16-28)29-17-9-4-10-18-29)24-32(40)41(38)35(44)37-22-26-12-5-2-6-13-26/h2-19,21,30-32H,20,22-25H2,1H3,(H,37,44)/t31-,32-/m0/s1 |
| InChIKey | OHVLTGLWXBTADE-ACHIHNKUSA-N |
| XLogP | 4.87 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|