C12H11N7O3 — CID 148771208
amino 4-aminooxy-2-(1H-indazol-6-ylamino)pyrimidine-5-carboxylate (PubChem CID 148771208) has the molecular formula C12H11N7O3 and a molecular weight of 301.27 g/mol. Its IUPAC name is amino 4-aminooxy-2-(1H-indazol-6-ylamino)pyrimidine-5-carboxylate.
| Compound Name | amino 4-aminooxy-2-(1H-indazol-6-ylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 148771208 |
| Molecular Formula | C12H11N7O3 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | amino 4-aminooxy-2-(1H-indazol-6-ylamino)pyrimidine-5-carboxylate |
| SMILES | NOC(=O)c1cnc(Nc2ccc3cn[nH]c3c2)nc1ON |
| InChI | InChI=1S/C12H11N7O3/c13-21-10-8(11(20)22-14)5-15-12(18-10)17-7-2-1-6-4-16-19-9(6)3-7/h1-5H,13-14H2,(H,16,19)(H,15,17,18) |
| InChIKey | OILCHJHNGMITOG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|