C17H15N7S — CID 143015941
S-[2-[[2-(1H-indazol-6-ylamino)pyrimidin-4-yl]amino]phenyl]thiohydroxylamine (PubChem CID 143015941) has the molecular formula C17H15N7S and a molecular weight of 349.42 g/mol. Its IUPAC name is S-[2-[[2-(1H-indazol-6-ylamino)pyrimidin-4-yl]amino]phenyl]thiohydroxylamine.
| Compound Name | S-[2-[[2-(1H-indazol-6-ylamino)pyrimidin-4-yl]amino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 143015941 |
| Molecular Formula | C17H15N7S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | S-[2-[[2-(1H-indazol-6-ylamino)pyrimidin-4-yl]amino]phenyl]thiohydroxylamine |
| SMILES | NSc1ccccc1Nc1ccnc(Nc2ccc3cn[nH]c3c2)n1 |
| InChI | InChI=1S/C17H15N7S/c18-25-15-4-2-1-3-13(15)22-16-7-8-19-17(23-16)21-12-6-5-11-10-20-24-14(11)9-12/h1-10H,18H2,(H,20,24)(H2,19,21,22,23) |
| InChIKey | VEBDJRJACOYLHR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|