C20H21N7O3S — CID 126962219
3-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]-N-propan-2-yloxybenzenesulfonamide (PubChem CID 126962219) has the molecular formula C20H21N7O3S and a molecular weight of 439.50 g/mol. Its IUPAC name is 3-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]-N-propan-2-yloxybenzenesulfonamide.
| Compound Name | 3-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]-N-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 126962219 |
| Molecular Formula | C20H21N7O3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]-N-propan-2-yloxybenzenesulfonamide |
| SMILES | CC(C)ONS(=O)(=O)c1cccc(Nc2nccc(Nc3cccc4[nH]ncc34)n2)c1 |
| InChI | InChI=1S/C20H21N7O3S/c1-13(2)30-27-31(28,29)15-6-3-5-14(11-15)23-20-21-10-9-19(25-20)24-17-7-4-8-18-16(17)12-22-26-18/h3-13,27H,1-2H3,(H,22,26)(H2,21,23,24,25) |
| InChIKey | BWGWGTBXNPLKHA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 133.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|