C22H23N7O2S — CID 126962220
4-N-(1H-indazol-4-yl)-2-N-(3-piperidin-1-ylsulfonylphenyl)pyrimidine-2,4-diamine (PubChem CID 126962220) has the molecular formula C22H23N7O2S and a molecular weight of 449.54 g/mol. Its IUPAC name is 4-N-(1H-indazol-4-yl)-2-N-(3-piperidin-1-ylsulfonylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1H-indazol-4-yl)-2-N-(3-piperidin-1-ylsulfonylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 126962220 |
| Molecular Formula | C22H23N7O2S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 4-N-(1H-indazol-4-yl)-2-N-(3-piperidin-1-ylsulfonylphenyl)pyrimidine-2,4-diamine |
| SMILES | O=S(=O)(c1cccc(Nc2nccc(Nc3cccc4[nH]ncc34)n2)c1)N1CCCCC1 |
| InChI | InChI=1S/C22H23N7O2S/c30-32(31,29-12-2-1-3-13-29)17-7-4-6-16(14-17)25-22-23-11-10-21(27-22)26-19-8-5-9-20-18(19)15-24-28-20/h4-11,14-15H,1-3,12-13H2,(H,24,28)(H2,23,25,26,27) |
| InChIKey | KTNNUUVULDGRKL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |