About 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione
5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione (PubChem CID 126962213) has the molecular formula C19H13N7O2
and a molecular weight of 371.36 g/mol. Its IUPAC name is 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione |
| PubChem CID | 126962213 |
| Molecular Formula | C19H13N7O2 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(Nc3nccc(Nc4cccc5[nH]ncc45)n3)ccc21 |
| InChI | InChI=1S/C19H13N7O2/c27-17-11-5-4-10(8-12(11)18(28)25-17)22-19-20-7-6-16(24-19)23-14-2-1-3-15-13(14)9-21-26-15/h1-9H,(H,21,26)(H,25,27,28)(H2,20,22,23,24) |
| InChIKey | DYELFNAGOMVUGC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione?
The IUPAC name of 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione (CID 126962213) is 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione.
What is the SMILES notation for 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione?
The canonical SMILES for 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione is O=C1NC(=O)c2cc(Nc3nccc(Nc4cccc5[nH]ncc45)n3)ccc21.
What is the InChIKey of 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione?
The InChIKey is DYELFNAGOMVUGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N7O2/c27-17-11-5-4-10(8-12(11)18(28)25-17)22-19-20-7-6-16(24-19)23-14-2-1-3-15-13(14)9-21-26-15/h1-9H,(H,21,26)(H,25,27,28)(H2,20,22,23,24).
What are the key properties of 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione?
5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione has a molecular weight of 371.36 g/mol, XLogP of 2.72, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-(1H-indazol-4-ylamino)pyrimidin-2-yl]amino]isoindole-1,3-dione is sourced from PubChem (CID 126962213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).