C18H19N5O4S — CID 40709731
N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1H-indazol-5-amine (PubChem CID 40709731) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1H-indazol-5-amine.
| Compound Name | N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1H-indazol-5-amine |
|---|---|
| PubChem CID | 40709731 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1H-indazol-5-amine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C18H19N5O4S/c24-23(25)18-11-15(28(26,27)22-8-2-1-3-9-22)5-7-17(18)20-14-4-6-16-13(10-14)12-19-21-16/h4-7,10-12,20H,1-3,8-9H2,(H,19,21) |
| InChIKey | FQEXHNNPUIKSNP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|