C27H28N2O3 — CID 148779176
3-[1-[2-[4-(2-methoxyethoxy)phenyl]propan-2-ylamino]ethenyl]-10H-acridin-9-one (PubChem CID 148779176) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 3-[1-[2-[4-(2-methoxyethoxy)phenyl]propan-2-ylamino]ethenyl]-10H-acridin-9-one.
| Compound Name | 3-[1-[2-[4-(2-methoxyethoxy)phenyl]propan-2-ylamino]ethenyl]-10H-acridin-9-one |
|---|---|
| PubChem CID | 148779176 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 3-[1-[2-[4-(2-methoxyethoxy)phenyl]propan-2-ylamino]ethenyl]-10H-acridin-9-one |
| SMILES | C=C(NC(C)(C)c1ccc(OCCOC)cc1)c1ccc2c(=O)c3ccccc3[nH]c2c1 |
| InChI | InChI=1S/C27H28N2O3/c1-18(29-27(2,3)20-10-12-21(13-11-20)32-16-15-31-4)19-9-14-23-25(17-19)28-24-8-6-5-7-22(24)26(23)30/h5-14,17,29H,1,15-16H2,2-4H3,(H,28,30) |
| InChIKey | OJYPXMXGORYXJK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|