C8H14N6O2 — CID 14877967
4-[2-(2H-tetrazol-5-yl)ethyl]piperazine-2-carboxylic acid (PubChem CID 14877967) has the molecular formula C8H14N6O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-[2-(2H-tetrazol-5-yl)ethyl]piperazine-2-carboxylic acid.
| Compound Name | 4-[2-(2H-tetrazol-5-yl)ethyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 14877967 |
| Molecular Formula | C8H14N6O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 4-[2-(2H-tetrazol-5-yl)ethyl]piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(CCc2nn[nH]n2)CCN1 |
| InChI | InChI=1S/C8H14N6O2/c15-8(16)6-5-14(4-2-9-6)3-1-7-10-12-13-11-7/h6,9H,1-5H2,(H,15,16)(H,10,11,12,13) |
| InChIKey | GXQNTGVRQAAYQI-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |