C8H17N2O5P — CID 70885147
(2R)-4-(3-dihydroxyphosphanyloxypropyl)piperazine-2-carboxylic acid (PubChem CID 70885147) has the molecular formula C8H17N2O5P and a molecular weight of 252.21 g/mol. Its IUPAC name is (2R)-4-(3-dihydroxyphosphanyloxypropyl)piperazine-2-carboxylic acid.
| Compound Name | (2R)-4-(3-dihydroxyphosphanyloxypropyl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 70885147 |
| Molecular Formula | C8H17N2O5P |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (2R)-4-(3-dihydroxyphosphanyloxypropyl)piperazine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(CCCOP(O)O)CCN1 |
| InChI | InChI=1S/C8H17N2O5P/c11-8(12)7-6-10(4-2-9-7)3-1-5-15-16(13)14/h7,9,13-14H,1-6H2,(H,11,12)/t7-/m1/s1 |
| InChIKey | ZTTMUWJUUAGWKV-SSDOTTSWSA-N |
| XLogP | -1.04 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|