About 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline
2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline (PubChem CID 14878251) has the molecular formula C10H10Cl2FN3
and a molecular weight of 262.12 g/mol. Its IUPAC name is 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline.
Molecular Properties
| Compound Name | 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline |
| PubChem CID | 14878251 |
| Molecular Formula | C10H10Cl2FN3 |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline |
| SMILES | Fc1c(Cl)ccc(NCC2=NCCN2)c1Cl |
| InChI | InChI=1S/C10H10Cl2FN3/c11-6-1-2-7(9(12)10(6)13)16-5-8-14-3-4-15-8/h1-2,16H,3-5H2,(H,14,15) |
| InChIKey | BPXQVMQCUIJYQW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline?
The IUPAC name of 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline (CID 14878251) is 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline.
What is the SMILES notation for 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline?
The canonical SMILES for 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline is Fc1c(Cl)ccc(NCC2=NCCN2)c1Cl.
What is the InChIKey of 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline?
The InChIKey is BPXQVMQCUIJYQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2FN3/c11-6-1-2-7(9(12)10(6)13)16-5-8-14-3-4-15-8/h1-2,16H,3-5H2,(H,14,15).
What are the key properties of 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline?
2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline has a molecular weight of 262.12 g/mol, XLogP of 2.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-fluoroaniline is sourced from PubChem (CID 14878251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).