C18H21N2OW- — CID 148785469
N-(2-aminobenzene-4-id-1-yl)-2,3,4,5,6-pentamethylbenzamide;tungsten (PubChem CID 148785469) has the molecular formula C18H21N2OW- and a molecular weight of 465.22 g/mol. Its IUPAC name is N-(2-aminobenzene-4-id-1-yl)-2,3,4,5,6-pentamethylbenzamide;tungsten.
| Compound Name | N-(2-aminobenzene-4-id-1-yl)-2,3,4,5,6-pentamethylbenzamide;tungsten |
|---|---|
| PubChem CID | 148785469 |
| Molecular Formula | C18H21N2OW- |
| Molecular Weight | 465.22 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-(2-aminobenzene-4-id-1-yl)-2,3,4,5,6-pentamethylbenzamide;tungsten |
| SMILES | Cc1c(C)c(C)c(C(=O)Nc2cc[c-]cc2N)c(C)c1C.[W] |
| InChI | InChI=1S/C18H21N2O.W/c1-10-11(2)13(4)17(14(5)12(10)3)18(21)20-16-9-7-6-8-15(16)19;/h7-9H,19H2,1-5H3,(H,20,21);/q-1; |
| InChIKey | SUJLXJQJLRXUSQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|