C25H25ClN2O2 — CID 2250223
N-[2-chloro-5-(phenylcarbamoyl)phenyl]-2,3,4,5,6-pentamethylbenzamide (PubChem CID 2250223) has the molecular formula C25H25ClN2O2 and a molecular weight of 420.94 g/mol. Its IUPAC name is N-[2-chloro-5-(phenylcarbamoyl)phenyl]-2,3,4,5,6-pentamethylbenzamide.
| Compound Name | N-[2-chloro-5-(phenylcarbamoyl)phenyl]-2,3,4,5,6-pentamethylbenzamide |
|---|---|
| PubChem CID | 2250223 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[2-chloro-5-(phenylcarbamoyl)phenyl]-2,3,4,5,6-pentamethylbenzamide |
| SMILES | Cc1c(C)c(C)c(C(=O)Nc2cc(C(=O)Nc3ccccc3)ccc2Cl)c(C)c1C |
| InChI | InChI=1S/C25H25ClN2O2/c1-14-15(2)17(4)23(18(5)16(14)3)25(30)28-22-13-19(11-12-21(22)26)24(29)27-20-9-7-6-8-10-20/h6-13H,1-5H3,(H,27,29)(H,28,30) |
| InChIKey | DHFQCHZFIBDKNY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |