C24H18ClN3O2 — CID 86982673
N-[2-chloro-5-(phenylcarbamoyl)phenyl]-2-methylquinoline-3-carboxamide (PubChem CID 86982673) has the molecular formula C24H18ClN3O2 and a molecular weight of 415.88 g/mol. Its IUPAC name is N-[2-chloro-5-(phenylcarbamoyl)phenyl]-2-methylquinoline-3-carboxamide.
| Compound Name | N-[2-chloro-5-(phenylcarbamoyl)phenyl]-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 86982673 |
| Molecular Formula | C24H18ClN3O2 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[2-chloro-5-(phenylcarbamoyl)phenyl]-2-methylquinoline-3-carboxamide |
| SMILES | Cc1nc2ccccc2cc1C(=O)Nc1cc(C(=O)Nc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C24H18ClN3O2/c1-15-19(13-16-7-5-6-10-21(16)26-15)24(30)28-22-14-17(11-12-20(22)25)23(29)27-18-8-3-2-4-9-18/h2-14H,1H3,(H,27,29)(H,28,30) |
| InChIKey | LINZKTUZWSRSSH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |