C24H24ClN3O2 — CID 87032124
N-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]-2-methylquinoline-3-carboxamide (PubChem CID 87032124) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is N-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]-2-methylquinoline-3-carboxamide.
| Compound Name | N-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 87032124 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]-2-methylquinoline-3-carboxamide |
| SMILES | Cc1nc2ccccc2cc1C(=O)Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C24H24ClN3O2/c1-15-19(13-16-7-5-6-10-22(16)26-15)23(29)28-18-11-12-21(25)20(14-18)24(30)27-17-8-3-2-4-9-17/h5-7,10-14,17H,2-4,8-9H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | PDWUKOVPCAAFQB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |