C20H14ClF2NO4 — CID 14878855
[6-(4-chloro-2,3-difluorophenoxy)-3-pyridinyl]-(3,4-dimethoxyphenyl)methanone (PubChem CID 14878855) has the molecular formula C20H14ClF2NO4 and a molecular weight of 405.78 g/mol. Its IUPAC name is [6-(4-chloro-2,3-difluorophenoxy)-3-pyridinyl]-(3,4-dimethoxyphenyl)methanone.
| Compound Name | [6-(4-chloro-2,3-difluorophenoxy)-3-pyridinyl]-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 14878855 |
| Molecular Formula | C20H14ClF2NO4 |
| Molecular Weight | 405.78 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | [6-(4-chloro-2,3-difluorophenoxy)-3-pyridinyl]-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccc(Oc3ccc(Cl)c(F)c3F)nc2)cc1OC |
| InChI | InChI=1S/C20H14ClF2NO4/c1-26-14-6-3-11(9-16(14)27-2)20(25)12-4-8-17(24-10-12)28-15-7-5-13(21)18(22)19(15)23/h3-10H,1-2H3 |
| InChIKey | KSMLXVZLEQIGPG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.78 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|