C16H10Cl2F4N2O2 — CID 14879197
N-[(3,5-dichloro-2,4-difluorophenyl)-methylcarbamoyl]-2,6-difluoro-N-methylbenzamide (PubChem CID 14879197) has the molecular formula C16H10Cl2F4N2O2 and a molecular weight of 409.17 g/mol. Its IUPAC name is N-[(3,5-dichloro-2,4-difluorophenyl)-methylcarbamoyl]-2,6-difluoro-N-methylbenzamide.
| Compound Name | N-[(3,5-dichloro-2,4-difluorophenyl)-methylcarbamoyl]-2,6-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 14879197 |
| Molecular Formula | C16H10Cl2F4N2O2 |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | N-[(3,5-dichloro-2,4-difluorophenyl)-methylcarbamoyl]-2,6-difluoro-N-methylbenzamide |
| SMILES | CN(C(=O)c1c(F)cccc1F)C(=O)N(C)c1cc(Cl)c(F)c(Cl)c1F |
| InChI | InChI=1S/C16H10Cl2F4N2O2/c1-23(10-6-7(17)13(21)12(18)14(10)22)16(26)24(2)15(25)11-8(19)4-3-5-9(11)20/h3-6H,1-2H3 |
| InChIKey | DXZUOYASSVYEDY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|